Products 39625-10-0

CAS 39625-10-0 appears in our catalog under these names: 2,2-Difluoro-2-phenylethanamine hydrochloride, 98%, 2,2-Difluoro-2-phenylethanamine HCl, 98%, 2,2-Difluoro-2-phenylethanamine HCl. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g.

Structural formula: {0} (CAS {1})

2,2-difluoro-2-phenylethanamine;hydrochloride (CAS 39625-10-0) is a chemical compound with the molecular formula C8H10ClF2N and a molecular weight of 193.62 g/mol. IUPAC name: 2,2-difluoro-2-phenylethanamine;hydrochloride. InChIKey: XFEYOJKYXHRUQQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10ClF2N
Molecular weight193.62 g/mol
IUPAC name2,2-difluoro-2-phenylethanamine;hydrochloride
InChIKeyXFEYOJKYXHRUQQ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(CN)(F)F.Cl

Computed by PubChem (NCBI)