Products 39674-97-0
CAS 39674-97-0 appears in our catalog under these names: Bvt 948, 95%, BVT948/ 98.7% (existing batch purity), BVT 948, BVT.948, BVT948 99%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 50 mg, 10 mg.
3,3-dimethyl-1H-benzo[g]indole-2,4,5-trione (CAS 39674-97-0) is a chemical compound with the molecular formula C14H11NO3 and a molecular weight of 241.24 g/mol. IUPAC name: 3,3-dimethyl-1H-benzo[g]indole-2,4,5-trione. InChIKey: LLPBUXODFQZPFH-UHFFFAOYSA-N.
| Molecular formula | C14H11NO3 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | 3,3-dimethyl-1H-benzo[g]indole-2,4,5-trione |
| InChIKey | LLPBUXODFQZPFH-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C3=CC=CC=C3C(=O)C2=O)NC1=O)C |
Computed by PubChem (NCBI)
Synonyms:
4-Hydroxy-3,3-dimethyl-2H-benzo[g]indole-2,5(3H)-dione, 4-Hydroxy-3,3-dimethyl-2H-benzo(g)indole-2,5(3H)-dione, 3,3-dimethyl-1H-benzo[g]indole-2,4,5-trione, Tocris-2176, 4-Hydroxy-3,3-, orb1308510, 4-Hydroxy-3,3-dimethyl-2H-benz[g]indole-2,5(3H)-dione, LLPBUXODFQZPFH-UHFFFAOYSA-N, s9829, BVT.948, >=98% (HPLC), solid