Products 39799-73-0
CAS 39799-73-0 appears in our catalog under these names: Methyl 4-benzamidobenzoate, 96%, Methyl 4-benzamidobenzoate, 98%, 98%, Methyl 4-benzamidobenzoate, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
Methyl 4-benzamidobenzoate (CAS 39799-73-0) is a chemical compound with the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. IUPAC name: methyl 4-benzamidobenzoate. InChIKey: GPQCAISAMTWGKJ-UHFFFAOYSA-N.
| Molecular formula | C15H13NO3 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | methyl 4-benzamidobenzoate |
| InChIKey | GPQCAISAMTWGKJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)