Products 39878-43-8
CAS 39878-43-8 appears in our catalog under these names: 2-Chloro-1-(3,5-dihydroxyphenyl)ethan-1-one, 95%, Isoproterenol Impurity 2, Isoproterenol Impurity 5, Adrenaline Impurity 9, 2-Chloro-1-(3,5-dihydroxyphenyl)ethanone. Offered by: Combi-blocks, Chemat Brand, Hubei YoungXin, TRC, GLPBio. Available pack sizes: 100mg, 250mg, on request, 10mg, 25mg, 50mg, 200mg.
2-chloro-1-(3,5-dihydroxyphenyl)ethanone (CAS 39878-43-8) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: 2-chloro-1-(3,5-dihydroxyphenyl)ethanone. InChIKey: ASZDQGFVJIMRRQ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 2-chloro-1-(3,5-dihydroxyphenyl)ethanone |
| InChIKey | ASZDQGFVJIMRRQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1O)O)C(=O)CCl |
Computed by PubChem (NCBI)