CAS 40200-69-9 appears in our catalog under these names: 4-Formyl-trans-stilbene, 95%, 4–Formyl–trans–stilbene, 4-Formyl-trans-stilbene, >98.0%(GC), (E)-4-Styrylbenzaldehyde 98%, TRANS-4-STILBENECARBOXALDEHYDE, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 5g, 25g, 1g, 250mg, 100mg.
4-[(E)-2-phenylethenyl]benzaldehyde (CAS 40200-69-9) is a chemical compound with the molecular formula C15H12O and a molecular weight of 208.25 g/mol. IUPAC name: 4-[(E)-2-phenylethenyl]benzaldehyde. InChIKey: CLXSBHRRZNBTRT-VOTSOKGWSA-N.
| Molecular formula | C15H12O |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 4-[(E)-2-phenylethenyl]benzaldehyde |
| InChIKey | CLXSBHRRZNBTRT-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)