CAS 40251-62-5 is the registry number for 3-Chloro-4-(trifluoromethoxy)benzoyl fluoride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-4-(trifluoromethoxy)benzoyl fluoride (CAS 40251-62-5) is a chemical compound with the molecular formula C8H3ClF4O2 and a molecular weight of 242.55 g/mol. IUPAC name: 3-chloro-4-(trifluoromethoxy)benzoyl fluoride. InChIKey: FEKISPQYCCOXGE-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF4O2 |
|---|---|
| Molecular weight | 242.55 g/mol |
| IUPAC name | 3-chloro-4-(trifluoromethoxy)benzoyl fluoride |
| InChIKey | FEKISPQYCCOXGE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)F)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)