CAS 40276-09-3 is the registry number for 2-Benzyloxy-trans-beta-nitrostyrene, 97%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-[(E)-2-nitroethenyl]-2-phenylmethoxybenzene (CAS 40276-09-3) is a chemical compound with the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. IUPAC name: 1-[(E)-2-nitroethenyl]-2-phenylmethoxybenzene. InChIKey: SQPQKZLZYZFJBK-ZHACJKMWSA-N.
| Molecular formula | C15H13NO3 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | 1-[(E)-2-nitroethenyl]-2-phenylmethoxybenzene |
| InChIKey | SQPQKZLZYZFJBK-ZHACJKMWSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC=C2/C=C/[N+](=O)[O-] |
Computed by PubChem (NCBI)