Products 402767-66-2

CAS 402767-66-2 appears in our catalog under these names: 5-(Naphthalen-1-yloxymethyl)furan-2-carboxylic acid, 5-((Naphthalen-1-yloxy)methyl)furan-2-carboxylic acid, 95+%, 95+%, 5-(Naphthalen-1-yloxymethyl)furan-2-carboxylic acid, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 2,5g, 1g, 5g, 500mg.

Structural formula: {0} (CAS {1})

5-(naphthalen-1-yloxymethyl)furan-2-carboxylic acid (CAS 402767-66-2) is a chemical compound with the molecular formula C16H12O4 and a molecular weight of 268.26 g/mol. IUPAC name: 5-(naphthalen-1-yloxymethyl)furan-2-carboxylic acid. InChIKey: DVUUCZPXJSZJNK-UHFFFAOYSA-N.

Identity
Molecular formulaC16H12O4
Molecular weight268.26 g/mol
IUPAC name5-(naphthalen-1-yloxymethyl)furan-2-carboxylic acid
InChIKeyDVUUCZPXJSZJNK-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=CC=C2OCC3=CC=C(O3)C(=O)O

Computed by PubChem (NCBI)