CAS 40288-69-5 appears in our catalog under these names: N–(2–Cyanophenyl)benzamide, N-(2-Cyanophenyl)benzamide, 95%, 95%, n-(2-Cyanophenyl)benzamide, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
N-(2-cyanophenyl)benzamide (CAS 40288-69-5) is a chemical compound with the molecular formula C14H10N2O and a molecular weight of 222.24 g/mol. IUPAC name: N-(2-cyanophenyl)benzamide. InChIKey: IQAAKQSNMORTCT-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | N-(2-cyanophenyl)benzamide |
| InChIKey | IQAAKQSNMORTCT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC=CC=C2C#N |
Computed by PubChem (NCBI)