Products 403823-09-6

CAS 403823-09-6 is the registry number for 2-(2-Chlorobenzyl)-3-methylbutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(2-chlorophenyl)methyl]-3-methylbutanoic acid (CAS 403823-09-6) is a chemical compound with the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. IUPAC name: 2-[(2-chlorophenyl)methyl]-3-methylbutanoic acid. InChIKey: PKCOUFCALPKNEL-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15ClO2
Molecular weight226.70 g/mol
IUPAC name2-[(2-chlorophenyl)methyl]-3-methylbutanoic acid
InChIKeyPKCOUFCALPKNEL-UHFFFAOYSA-N
SMILESCC(C)C(CC1=CC=CC=C1Cl)C(=O)O

Computed by PubChem (NCBI)