CAS 404010-98-6 appears in our catalog under these names: 4-Morpholin-4-yl-2-nitrobenzoic acid 95%, 4-Morpholino-2-nitrobenzoic acid, 95%, 95%, 4-Morpholin-4-yl-2-nitrobenzoic acid, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
4-morpholin-4-yl-2-nitrobenzoic acid (CAS 404010-98-6) is a chemical compound with the molecular formula C11H12N2O5 and a molecular weight of 252.22 g/mol. IUPAC name: 4-morpholin-4-yl-2-nitrobenzoic acid. InChIKey: XTCFTNJWMQVACD-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O5 |
|---|---|
| Molecular weight | 252.22 g/mol |
| IUPAC name | 4-morpholin-4-yl-2-nitrobenzoic acid |
| InChIKey | XTCFTNJWMQVACD-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC(=C(C=C2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)