CAS 404827-81-2 appears in our catalog under these names: 4-Chloro-2-(2-chlorophenyl)-5,6-dimethylpyrimidine, 4-Chloro-2-(2-chlorophenyl)-5,6-dimethylpyrimidine, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 5g.
4-chloro-2-(2-chlorophenyl)-5,6-dimethylpyrimidine (CAS 404827-81-2) is a chemical compound with the molecular formula C12H10Cl2N2 and a molecular weight of 253.12 g/mol. IUPAC name: 4-chloro-2-(2-chlorophenyl)-5,6-dimethylpyrimidine. InChIKey: GQQWQCGGHAWKAF-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2N2 |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | 4-chloro-2-(2-chlorophenyl)-5,6-dimethylpyrimidine |
| InChIKey | GQQWQCGGHAWKAF-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(N=C1Cl)C2=CC=CC=C2Cl)C |
Computed by PubChem (NCBI)