CAS 40620-54-0 appears in our catalog under these names: (3R)-3-(3-Chlorophenyl)-3-hydroxypropanoic acid, 95%, (R)–3–(3–chlorophenyl)–3–hydroxypropanoic acid, (3R)-3-(3-Chlorophenyl)-3-hydroxypropanoic acid, (R)-3-(3-chlorophenyl)-3-hydroxypropanoic acid, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 0,5g, 50mg.
(3R)-3-(3-chlorophenyl)-3-hydroxypropanoic acid (CAS 40620-54-0) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: (3R)-3-(3-chlorophenyl)-3-hydroxypropanoic acid. InChIKey: SUGIWOQOKKWXRH-MRVPVSSYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | (3R)-3-(3-chlorophenyl)-3-hydroxypropanoic acid |
| InChIKey | SUGIWOQOKKWXRH-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)[C@@H](CC(=O)O)O |
Computed by PubChem (NCBI)