CAS 625095-56-9 appears in our catalog under these names: (S)-3-(3-Chlorophenyl)-3-hydroxypropanoic acid, 95%, (3S)-3-(3-Chlorophenyl)-3-hydroxypropanoic acid, (S)-3-(3-chlorophenyl)-3-hydroxypropanoic acid 97%, (S)-3-(3-chlorophenyl)-3-hydroxypropanoic acid, 97%, 97%, (S)-3-(3-chlorophenyl)-3-hydroxypropanoic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 0,5g.
(3S)-3-(3-chlorophenyl)-3-hydroxypropanoic acid (CAS 625095-56-9) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: (3S)-3-(3-chlorophenyl)-3-hydroxypropanoic acid. InChIKey: SUGIWOQOKKWXRH-QMMMGPOBSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | (3S)-3-(3-chlorophenyl)-3-hydroxypropanoic acid |
| InChIKey | SUGIWOQOKKWXRH-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)[C@H](CC(=O)O)O |
Computed by PubChem (NCBI)