CAS 4071-18-5 appears in our catalog under these names: 2,6-Dihydro-2,2,4-trimethyl-6-quinolone, >95% (HPLC), 2,2,4–trimethylquinolin–6(2H)–one, 2,2,4-Trimethyl-6(2H)-quinolinone. Offered by: TRC, GLPBio, HPC Standards. Available pack sizes: 1mg, 2,5mg, 5mg, 1x25mg, 1x5mg.
2,2,4-trimethylquinolin-6-one (CAS 4071-18-5) is a chemical compound with the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. IUPAC name: 2,2,4-trimethylquinolin-6-one. InChIKey: JPOWOWQYHLDQDB-UHFFFAOYSA-N.
| Molecular formula | C12H13NO |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 2,2,4-trimethylquinolin-6-one |
| InChIKey | JPOWOWQYHLDQDB-UHFFFAOYSA-N |
| SMILES | CC1=CC(N=C2C1=CC(=O)C=C2)(C)C |
Computed by PubChem (NCBI)