Products 408511-61-5

CAS 408511-61-5 is the registry number for 3-Mesitylpropiolic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(2,4,6-trimethylphenyl)prop-2-ynoic acid (CAS 408511-61-5) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. IUPAC name: 3-(2,4,6-trimethylphenyl)prop-2-ynoic acid. InChIKey: RCDFGZLJNAKRKC-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12O2
Molecular weight188.22 g/mol
IUPAC name3-(2,4,6-trimethylphenyl)prop-2-ynoic acid
InChIKeyRCDFGZLJNAKRKC-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1)C)C#CC(=O)O)C

Computed by PubChem (NCBI)