CAS 408511-61-5 is the registry number for 3-Mesitylpropiolic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,4,6-trimethylphenyl)prop-2-ynoic acid (CAS 408511-61-5) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. IUPAC name: 3-(2,4,6-trimethylphenyl)prop-2-ynoic acid. InChIKey: RCDFGZLJNAKRKC-UHFFFAOYSA-N.
| Molecular formula | C12H12O2 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | 3-(2,4,6-trimethylphenyl)prop-2-ynoic acid |
| InChIKey | RCDFGZLJNAKRKC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C#CC(=O)O)C |
Computed by PubChem (NCBI)