CAS 40856-80-2 appears in our catalog under these names: (S)-5-((1H-indol-3-yl)methyl)imidazolidine-2,4-dione, (5S)-5-(1H-Indol-3-ylmethyl)-2,4-Imidazolidinedione, (S)-5-((1H-Indol-3-yl)methyl)imidazolidine-2,4-dione, 97%, (5S)-5-((1H-Indol-3-yl)methyl)imidazolidine-2,4-dione. Offered by: Chemat Brand, TRC, AmBeed, Biosynth. Available pack sizes: on request, 750mg, 10g, 1g, 100mg.
(5S)-5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione (CAS 40856-80-2) is a chemical compound with the molecular formula C12H11N3O2 and a molecular weight of 229.23 g/mol. IUPAC name: (5S)-5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione. InChIKey: RUUREKIGAKIKIL-JTQLQIEISA-N.
| Molecular formula | C12H11N3O2 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | (5S)-5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione |
| InChIKey | RUUREKIGAKIKIL-JTQLQIEISA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@H]3C(=O)NC(=O)N3 |
Computed by PubChem (NCBI)