Products 40985-43-1
CAS 40985-43-1 is the registry number for (1S)-3-Oxo-2,3-dihydro-1H-indene-1-carboxylic acid, 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(1S)-3-oxo-1,2-dihydroindene-1-carboxylic acid (CAS 40985-43-1) is a chemical compound with the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. IUPAC name: (1S)-3-oxo-1,2-dihydroindene-1-carboxylic acid. InChIKey: HXLJFMRZKCSTQD-QMMMGPOBSA-N.
| Molecular formula | C10H8O3 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | (1S)-3-oxo-1,2-dihydroindene-1-carboxylic acid |
| InChIKey | HXLJFMRZKCSTQD-QMMMGPOBSA-N |
| SMILES | C1[C@@H](C2=CC=CC=C2C1=O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(1S)-3-Oxo-2,3-dihydro-1H-indene-1-carboxylic acid, (1S)-3-oxo-1,2-dihydroindene-1-carboxylic acid, (S)-3-Oxo-2,3-dihydro-1H-indene-1-carboxylic acid, (S)-3-Oxoindane-1-carboxylic acid, (1S)-3-Oxo-2,3-dihydro-1H-indene-1-carboxylicacid, 1H-Indene-1-carboxylic acid, 2,3-dihydro-3-oxo-, (1S)-