Products 41009-88-5
CAS 41009-88-5 appears in our catalog under these names: 3,3',3''–(Benzene–1,3,5–triyl)triacrylicacid, 3，3'，3''-(Benzene-1，3，5-triyl)triacrylic acid, 98%, 98%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 500mg, 250mg, 1g.
(E)-3-[3,5-bis[(E)-2-carboxyethenyl]phenyl]prop-2-enoic acid (CAS 41009-88-5) is a chemical compound with the molecular formula C15H12O6 and a molecular weight of 288.25 g/mol. IUPAC name: (E)-3-[3,5-bis[(E)-2-carboxyethenyl]phenyl]prop-2-enoic acid. InChIKey: OYJYITDWCXDYQZ-GZDDRBCLSA-N.
| Molecular formula | C15H12O6 |
|---|---|
| Molecular weight | 288.25 g/mol |
| IUPAC name | (E)-3-[3,5-bis[(E)-2-carboxyethenyl]phenyl]prop-2-enoic acid |
| InChIKey | OYJYITDWCXDYQZ-GZDDRBCLSA-N |
| SMILES | C1=C(C=C(C=C1/C=C/C(=O)O)/C=C/C(=O)O)/C=C/C(=O)O |
Computed by PubChem (NCBI)