CAS 41078-01-7 appears in our catalog under these names: 3-Ethyl-1H-purine-2,6(3H,7H)-dione, 95%, 3-Ethyl-1H-purine-2,6(3H,7H)-dione, 95%, 95%, 3-Ethyl-3,7-dihydro-1H-purine-2,6-dione, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 50mg, 100mg, 250mg, 1g.
3-ethyl-7H-purine-2,6-dione (CAS 41078-01-7) is a chemical compound with the molecular formula C7H8N4O2 and a molecular weight of 180.16 g/mol. IUPAC name: 3-ethyl-7H-purine-2,6-dione. InChIKey: OTUCSVCIIQRSNG-UHFFFAOYSA-N.
| Molecular formula | C7H8N4O2 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 3-ethyl-7H-purine-2,6-dione |
| InChIKey | OTUCSVCIIQRSNG-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C(=O)NC1=O)NC=N2 |
Computed by PubChem (NCBI)