CAS 41146-42-3 is the registry number for (2,6-Dichlorophenyl)urea, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(2,6-dichlorophenyl)urea (CAS 41146-42-3) is a chemical compound with the molecular formula C7H6Cl2N2O and a molecular weight of 205.04 g/mol. IUPAC name: (2,6-dichlorophenyl)urea. InChIKey: OODROUUHJQWALW-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O |
|---|---|
| Molecular weight | 205.04 g/mol |
| IUPAC name | (2,6-dichlorophenyl)urea |
| InChIKey | OODROUUHJQWALW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)NC(=O)N)Cl |
Computed by PubChem (NCBI)