CAS 4116-38-5 appears in our catalog under these names: 1,3–Dimethylorotic acid, 1,3-Dimethyl-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid 98+%, 1,3-Dimethyl-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid, 98+%, 98+%, 1,3-Dimethylorotic acid, 98+%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
1,3-dimethyl-2,6-dioxopyrimidine-4-carboxylic acid (CAS 4116-38-5) is a chemical compound with the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. IUPAC name: 1,3-dimethyl-2,6-dioxopyrimidine-4-carboxylic acid. InChIKey: ZXDYFTWNWCMEOS-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 1,3-dimethyl-2,6-dioxopyrimidine-4-carboxylic acid |
| InChIKey | ZXDYFTWNWCMEOS-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=O)N(C1=O)C)C(=O)O |
Computed by PubChem (NCBI)