Products 41169-42-0
CAS 41169-42-0 appears in our catalog under these names: 2,2-Dimethyl-1,3-diphenylpropane-1,3-dione, 2,2-Dimethyl-1,3-diphenylpropane-1,3-dione, 98%, 98%, 2,2-Dimethyl-1,3-diphenylpropane-1,3-dione, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 500mg, 1g.
2,2-dimethyl-1,3-diphenylpropane-1,3-dione (CAS 41169-42-0) is a chemical compound with the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. IUPAC name: 2,2-dimethyl-1,3-diphenylpropane-1,3-dione. InChIKey: ZCQWHDYGRXASIN-UHFFFAOYSA-N.
| Molecular formula | C17H16O2 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | 2,2-dimethyl-1,3-diphenylpropane-1,3-dione |
| InChIKey | ZCQWHDYGRXASIN-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)C1=CC=CC=C1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)