CAS 412018-50-9 appears in our catalog under these names: 3–Acetyl–2,6–dichloropyridine, 3-Acetyl-2,6-dichloropyridine 95%, 3-Acetyl-2,6-dichloropyridine, 98%, 98%, 1-(2,6-Dichloropyridin-3-yl)ethanone, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 25g, 50mg, 10g, 100g.
1-(2,6-dichloro-3-pyridinyl)ethanone (CAS 412018-50-9) is a chemical compound with the molecular formula C7H5Cl2NO and a molecular weight of 190.02 g/mol. IUPAC name: 1-(2,6-dichloro-3-pyridinyl)ethanone. InChIKey: XOEFQKGFPDZVKF-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO |
|---|---|
| Molecular weight | 190.02 g/mol |
| IUPAC name | 1-(2,6-dichloro-3-pyridinyl)ethanone |
| InChIKey | XOEFQKGFPDZVKF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(N=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)