CAS 4133-34-0 appears in our catalog under these names: 7–Methoxy–2–tetralone, 7-Methoxy-2-tetralone, 7-Methoxy-2-tetralone, 95%, 7-Methoxy-2-tetralone 98%, 3,4-Dihydro-7-Methoxy-2(1H)-Naphthalenone, 97%, 97%. Offered by: GLPBio, Biosynth, Thermo Scientific (Acros), Ambeed, Chemat. Available pack sizes: 100g, 25g, 10g, 5g, 50g, 1000g, 250mg, 1g.
7-methoxy-3,4-dihydro-1H-naphthalen-2-one (CAS 4133-34-0) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 7-methoxy-3,4-dihydro-1H-naphthalen-2-one. InChIKey: XEAPZXNZOJGVCZ-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 7-methoxy-3,4-dihydro-1H-naphthalen-2-one |
| InChIKey | XEAPZXNZOJGVCZ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(CCC(=O)C2)C=C1 |
Computed by PubChem (NCBI)