Products 41374-62-3
CAS 41374-62-3 appears in our catalog under these names: [(4-Methoxyphenyl)amino](oxo)acetic acid, 96%, 2-((4-Methoxyphenyl)amino)-2-oxoacetic acid, 98%, 2–((4–Methoxyphenyl)amino)–2–oxoacetic acid, 2-((4-methoxyphenyl)amino)-2-oxoacetic acid, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 25g, 10g, 5g, 1g, 100mg.
2-(4-methoxyanilino)-2-oxoacetic acid (CAS 41374-62-3) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 2-(4-methoxyanilino)-2-oxoacetic acid. InChIKey: OHBNHGKGBOYRSB-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 2-(4-methoxyanilino)-2-oxoacetic acid |
| InChIKey | OHBNHGKGBOYRSB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NC(=O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
[(4-methoxyphenyl)carbamoyl]formic acid, ((4-methoxyphenyl)carbamoyl)formic acid, [(4-methoxyphenyl)amino](oxo)acetic acid, 2-((4-Methoxyphenyl)amino)-2-oxoacetic acid, 2-(4-methoxyanilino)-2-oxoacetic acid, 2-[(4-Methoxyphenyl)amino]-2-oxoacetic Acid, N-4-methoxyphenyloxamic acid, (4-Methoxyanilino)(oxo)acetic acid, 2-(4-methoxyanilino)-2-oxo-acetic acid, N-(4-methoxyphenyl)methanecarboxylic acid