Products 41400-00-4
CAS 41400-00-4 appears in our catalog under these names: 4-Methyl-1H-pyrrole-2,3,5-tricarboxylic acid, 97%, 4-Methyl-1H-pyrrole-2,3,5-tricarboxylic acid, 97%, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-methyl-1H-pyrrole-2,3,5-tricarboxylic acid (CAS 41400-00-4) is a chemical compound with the molecular formula C8H7NO6 and a molecular weight of 213.14 g/mol. IUPAC name: 4-methyl-1H-pyrrole-2,3,5-tricarboxylic acid. InChIKey: GQXVVNWZVFKOGE-UHFFFAOYSA-N.
| Molecular formula | C8H7NO6 |
|---|---|
| Molecular weight | 213.14 g/mol |
| IUPAC name | 4-methyl-1H-pyrrole-2,3,5-tricarboxylic acid |
| InChIKey | GQXVVNWZVFKOGE-UHFFFAOYSA-N |
| SMILES | CC1=C(NC(=C1C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)