Products 41420-95-5
CAS 41420-95-5 is the registry number for 2-(3,4-Dichloro-phenyl)-5-methyl-[1,3,4]oxadiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(3,4-dichlorophenyl)-5-methyl-1,3,4-oxadiazole (CAS 41420-95-5) is a chemical compound with the molecular formula C9H6Cl2N2O and a molecular weight of 229.06 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)-5-methyl-1,3,4-oxadiazole. InChIKey: MRVVCFLGGAFDCD-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2O |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)-5-methyl-1,3,4-oxadiazole |
| InChIKey | MRVVCFLGGAFDCD-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(O1)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)