Products 415965-24-1
CAS 415965-24-1 appears in our catalog under these names: 4-Bromo-2-fluoro-5-methylbenzoic acid, 98%, 98%, 4-Bromo-2-fluoro-5-methylbenzoic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g.
4-bromo-2-fluoro-5-methylbenzoic acid (CAS 415965-24-1) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 4-bromo-2-fluoro-5-methylbenzoic acid. InChIKey: PJJJBQHQICIYJH-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 4-bromo-2-fluoro-5-methylbenzoic acid |
| InChIKey | PJJJBQHQICIYJH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)F)C(=O)O |
Computed by PubChem (NCBI)