CAS 41667-95-2 appears in our catalog under these names: 5,6-Dichloronicotinic acid, 5,6-Dichloronicotinic Acid, >98.0%(T), 5,6-Dichloronicotinic acid 98%, 5,6-Dichloronicotinic Acid, 98%, 98%, 5,6-Dichloronicotinic acid, 99.97%. Offered by: TRC, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 500mg, 0,5kg, 0,25kg, 5g, 25g, 1kg, 1g, 10g.
5,6-dichloropyridine-3-carboxylic acid (CAS 41667-95-2) is a chemical compound with the molecular formula C6H3Cl2NO2 and a molecular weight of 192.00 g/mol. IUPAC name: 5,6-dichloropyridine-3-carboxylic acid. InChIKey: RNRLTTNKVLFZJS-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO2 |
|---|---|
| Molecular weight | 192.00 g/mol |
| IUPAC name | 5,6-dichloropyridine-3-carboxylic acid |
| InChIKey | RNRLTTNKVLFZJS-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)