CAS 41709-87-9 appears in our catalog under these names: 4-Hydroxyisoindoline-1,3-dione, 97%, 4-Hydroxy-2,3-dihydro-1H-isoindole-1,3-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-hydroxyisoindole-1,3-dione (CAS 41709-87-9) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: 4-hydroxyisoindole-1,3-dione. InChIKey: XXYNZSATHOXXBJ-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 4-hydroxyisoindole-1,3-dione |
| InChIKey | XXYNZSATHOXXBJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)C(=O)NC2=O |
Computed by PubChem (NCBI)