CAS 41873-74-9 appears in our catalog under these names: p–Tolyl Crotonate, p-Tolyl Crotonate, >55.0%(GC). Offered by: GLPBio, TCI. Available pack sizes: 100ml, 25ml, 500ml.
(4-methylphenyl) (E)-but-2-enoate (CAS 41873-74-9) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: (4-methylphenyl) (E)-but-2-enoate. InChIKey: FGJQFRNEXKYBQC-ONEGZZNKSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | (4-methylphenyl) (E)-but-2-enoate |
| InChIKey | FGJQFRNEXKYBQC-ONEGZZNKSA-N |
| SMILES | C/C=C/C(=O)OC1=CC=C(C=C1)C |
Computed by PubChem (NCBI)