CAS 419540-45-7 is the registry number for 5-(3-Methoxyphenyl)-2,4-dihydro-3h-1,2,4-triazole-3-thione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-(3-methoxyphenyl)-1,2-dihydro-1,2,4-triazole-3-thione (CAS 419540-45-7) is a chemical compound with the molecular formula C9H9N3OS and a molecular weight of 207.25 g/mol. IUPAC name: 5-(3-methoxyphenyl)-1,2-dihydro-1,2,4-triazole-3-thione. InChIKey: RTTMZCCBDAJGRW-UHFFFAOYSA-N.
| Molecular formula | C9H9N3OS |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | 5-(3-methoxyphenyl)-1,2-dihydro-1,2,4-triazole-3-thione |
| InChIKey | RTTMZCCBDAJGRW-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=NC(=S)NN2 |
Computed by PubChem (NCBI)