CAS 42106-48-9 appears in our catalog under these names: 2–Morpholinobenzoic Acid, 2-(Morpholin-4-yl)benzoic acid, 2-Morpholinobenzoic acid 97%, 2-Morpholinobenzoic Acid, 96%, 96%, 2-morpholin-4-ylbenzoic acid, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg.
2-morpholin-4-ylbenzoic acid (CAS 42106-48-9) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: 2-morpholin-4-ylbenzoic acid. InChIKey: XUBUJTVBAXQIKG-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 2-morpholin-4-ylbenzoic acid |
| InChIKey | XUBUJTVBAXQIKG-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)