CAS 42310-83-8 is the registry number for 2-Bromo-2-methylpropane-d9, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.
2-bromo-1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propane (CAS 42310-83-8) is a chemical compound with the molecular formula C4H9Br and a molecular weight of 146.07 g/mol. IUPAC name: 2-bromo-1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propane. InChIKey: RKSOPLXZQNSWAS-GQALSZNTSA-N.
| Molecular formula | C4H9Br |
|---|---|
| Molecular weight | 146.07 g/mol |
| IUPAC name | 2-bromo-1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propane |
| InChIKey | RKSOPLXZQNSWAS-GQALSZNTSA-N |
| SMILES | [2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])Br |
Computed by PubChem (NCBI)