CAS 42337-64-4 appears in our catalog under these names: 1H–Indene–1,2(3H)–dione, 5,6–dimethoxy–, 5,6-Dimethoxy-1H-indene-1,2(3H)-dione 97%, 5,6-Dimethoxy-1H-indene-1,2(3H)-dione, 97%, 97%, 5,6-dimethoxy-1,2-indanedione, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
5,6-dimethoxy-3H-indene-1,2-dione (CAS 42337-64-4) is a chemical compound with the molecular formula C11H10O4 and a molecular weight of 206.19 g/mol. IUPAC name: 5,6-dimethoxy-3H-indene-1,2-dione. InChIKey: RKVYZYHBLAMLDG-UHFFFAOYSA-N.
| Molecular formula | C11H10O4 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | 5,6-dimethoxy-3H-indene-1,2-dione |
| InChIKey | RKVYZYHBLAMLDG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)CC(=O)C2=O)OC |
Computed by PubChem (NCBI)