Products 42374-33-4
CAS 42374-33-4 is the registry number for 5-Benzoyl-1,2,3,4-tetrahydropyridine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Phenyl(1,2,3,4-tetrahydropyridin-5-yl)methanone (CAS 42374-33-4) is a chemical compound with the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. IUPAC name: phenyl(1,2,3,4-tetrahydropyridin-5-yl)methanone. InChIKey: IDYMGCCCUQPQIG-UHFFFAOYSA-N.
| Molecular formula | C12H13NO |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | phenyl(1,2,3,4-tetrahydropyridin-5-yl)methanone |
| InChIKey | IDYMGCCCUQPQIG-UHFFFAOYSA-N |
| SMILES | C1CC(=CNC1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)