Products 42754-62-1
CAS 42754-62-1 is the registry number for 5-amino-3-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile, 98%. Offered by: Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
3-amino-5-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile (CAS 42754-62-1) is a chemical compound with the molecular formula C10H7ClN4 and a molecular weight of 218.64 g/mol. IUPAC name: 3-amino-5-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile. InChIKey: DWFJNGUSRCQFDM-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN4 |
|---|---|
| Molecular weight | 218.64 g/mol |
| IUPAC name | 3-amino-5-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile |
| InChIKey | DWFJNGUSRCQFDM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C(=NN2)N)C#N)Cl |
Computed by PubChem (NCBI)