Products 428468-34-2
CAS 428468-34-2 is the registry number for 4-((4-formylphenoxy)methyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
4-[(4-formylphenoxy)methyl]benzoic acid (CAS 428468-34-2) is a chemical compound with the molecular formula C15H12O4 and a molecular weight of 256.25 g/mol. IUPAC name: 4-[(4-formylphenoxy)methyl]benzoic acid. InChIKey: ZKWZTMPNUCKOTL-UHFFFAOYSA-N.
| Molecular formula | C15H12O4 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | 4-[(4-formylphenoxy)methyl]benzoic acid |
| InChIKey | ZKWZTMPNUCKOTL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1COC2=CC=C(C=C2)C=O)C(=O)O |
Computed by PubChem (NCBI)