CAS 428479-97-4 appears in our catalog under these names: 4-(Allyloxy)-3-chloro-5-methoxybenzaldehyde, 4-(Allyloxy)-3-chloro-5-methoxybenzaldehyde, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 2,5g, 1g.
3-chloro-5-methoxy-4-prop-2-enoxybenzaldehyde (CAS 428479-97-4) is a chemical compound with the molecular formula C11H11ClO3 and a molecular weight of 226.65 g/mol. IUPAC name: 3-chloro-5-methoxy-4-prop-2-enoxybenzaldehyde. InChIKey: HXTUEFQOQGLKHN-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO3 |
|---|---|
| Molecular weight | 226.65 g/mol |
| IUPAC name | 3-chloro-5-methoxy-4-prop-2-enoxybenzaldehyde |
| InChIKey | HXTUEFQOQGLKHN-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C=O)Cl)OCC=C |
Computed by PubChem (NCBI)