Products 42940-56-7
CAS 42940-56-7 appears in our catalog under these names: 7,9-Dioxo-8-azaspiro[4.5]decane-6,10-dicarbonitrile, 95%, Buspirone Impurity 12, 7,9-Dioxo-8-azaspiro(4.5)decane-6,10-dicarbonitrile, 97%. Offered by: Combi-blocks, Chemat Brand, AmBeed. Available pack sizes: 5g, 250mg, 1g, on request.
7,9-dioxo-8-azaspiro[4.5]decane-6,10-dicarbonitrile (CAS 42940-56-7) is a chemical compound with the molecular formula C11H11N3O2 and a molecular weight of 217.22 g/mol. IUPAC name: 7,9-dioxo-8-azaspiro[4.5]decane-6,10-dicarbonitrile. InChIKey: USIMPDHJLHKMKA-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O2 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 7,9-dioxo-8-azaspiro[4.5]decane-6,10-dicarbonitrile |
| InChIKey | USIMPDHJLHKMKA-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)C(C(=O)NC(=O)C2C#N)C#N |
Computed by PubChem (NCBI)