Products 431062-03-2
CAS 431062-03-2 appears in our catalog under these names: 6-Chloro-1-methyl-1h-indole-5-carboxylic acid, 95%, 6–Chloro–1–methyl–1H–indole–5–carboxylic acid, 6-chloro-1-methyl-1H-indole-5-carboxylic acid, 97%, 97%, 6-Chloro-1-methyl-1H-indole-5-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg.
6-chloro-1-methylindole-5-carboxylic acid (CAS 431062-03-2) is a chemical compound with the molecular formula C10H8ClNO2 and a molecular weight of 209.63 g/mol. IUPAC name: 6-chloro-1-methylindole-5-carboxylic acid. InChIKey: RTGGBNWGOOTSRD-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2 |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | 6-chloro-1-methylindole-5-carboxylic acid |
| InChIKey | RTGGBNWGOOTSRD-UHFFFAOYSA-N |
| SMILES | CN1C=CC2=CC(=C(C=C21)Cl)C(=O)O |
Computed by PubChem (NCBI)