CAS 4315-14-4 appears in our catalog under these names: 4,5-Dimethyl-2-nitrobenzoic acid, 95%, 3,4-Dimethyl-6-nitrobenzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 25g, 50g.
4,5-dimethyl-2-nitrobenzoic acid (CAS 4315-14-4) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 4,5-dimethyl-2-nitrobenzoic acid. InChIKey: XGXYTCSDJADEGC-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 4,5-dimethyl-2-nitrobenzoic acid |
| InChIKey | XGXYTCSDJADEGC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)