CAS 4335-90-4 appears in our catalog under these names: 3-Benzylidene-2,4-pentanedione, 95%, 3-Benzylidene-2,4-pentanedione, 97% , 3-Benzylidenepentane-2,4-dione, 98%, 98%, 3-Benzylidenepentane-2,4-dione, 98%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 250mg, 10g, 50g, 100g.
3-benzylidenepentane-2,4-dione (CAS 4335-90-4) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. IUPAC name: 3-benzylidenepentane-2,4-dione. InChIKey: NYRGMNMVISROGJ-UHFFFAOYSA-N.
| Molecular formula | C12H12O2 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | 3-benzylidenepentane-2,4-dione |
| InChIKey | NYRGMNMVISROGJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C(=CC1=CC=CC=C1)C(=O)C |
Computed by PubChem (NCBI)