CAS 436088-67-4 is the registry number for 4-(2-Chloro-acetyl)-3,4-dihydro-1h-quinoxalin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(2-chloroacetyl)-1,3-dihydroquinoxalin-2-one (CAS 436088-67-4) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: 4-(2-chloroacetyl)-1,3-dihydroquinoxalin-2-one. InChIKey: RNGJPXOEWSLROI-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 4-(2-chloroacetyl)-1,3-dihydroquinoxalin-2-one |
| InChIKey | RNGJPXOEWSLROI-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=CC=CC=C2N1C(=O)CCl |
Computed by PubChem (NCBI)