CAS 436089-00-8 is the registry number for 5,7-Dimethyl-2-phenylquinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5,7-dimethyl-2-phenylquinoline-4-carboxylic acid (CAS 436089-00-8) is a chemical compound with the molecular formula C18H15NO2 and a molecular weight of 277.3 g/mol. IUPAC name: 5,7-dimethyl-2-phenylquinoline-4-carboxylic acid. InChIKey: SDUUCTLUIVSXQM-UHFFFAOYSA-N.
| Molecular formula | C18H15NO2 |
|---|---|
| Molecular weight | 277.3 g/mol |
| IUPAC name | 5,7-dimethyl-2-phenylquinoline-4-carboxylic acid |
| InChIKey | SDUUCTLUIVSXQM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=CC(=NC2=C1)C3=CC=CC=C3)C(=O)O)C |
Computed by PubChem (NCBI)