CAS 4371-21-5 is the registry number for Strontium Ranelate Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.
5-(3,4,5-trihydroxyphenyl)benzene-1,2,3-triol (CAS 4371-21-5) is a chemical compound with the molecular formula C12H10O6 and a molecular weight of 250.20 g/mol. IUPAC name: 5-(3,4,5-trihydroxyphenyl)benzene-1,2,3-triol. InChIKey: UWULOIFHRZGDFB-UHFFFAOYSA-N.
| Molecular formula | C12H10O6 |
|---|---|
| Molecular weight | 250.20 g/mol |
| IUPAC name | 5-(3,4,5-trihydroxyphenyl)benzene-1,2,3-triol |
| InChIKey | UWULOIFHRZGDFB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1O)O)O)C2=CC(=C(C(=C2)O)O)O |
Computed by PubChem (NCBI)