CAS 832741-10-3 appears in our catalog under these names: Methyl 4-(1,3-benzodioxol-5-yl)-2,4-dioxobutanoate, 95%, Methyl 4-(1,3-dioxaindan-5-yl)-2,4-dioxobutanoate, Methyl 4-(benzo[d][1,3]dioxol-5-yl)-2,4-dioxobutanoate 97%, 4-Benzo[1,3]dioxol-5-yl-2,4-dioxo-butyric acid methyl ester, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 2,5g, 50mg, 500mg.
Methyl 4-(1,3-benzodioxol-5-yl)-2,4-dioxobutanoate (CAS 832741-10-3) is a chemical compound with the molecular formula C12H10O6 and a molecular weight of 250.20 g/mol. IUPAC name: methyl 4-(1,3-benzodioxol-5-yl)-2,4-dioxobutanoate. InChIKey: PIOJWDDCFUZORX-UHFFFAOYSA-N.
| Molecular formula | C12H10O6 |
|---|---|
| Molecular weight | 250.20 g/mol |
| IUPAC name | methyl 4-(1,3-benzodioxol-5-yl)-2,4-dioxobutanoate |
| InChIKey | PIOJWDDCFUZORX-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)C1=CC2=C(C=C1)OCO2 |
Computed by PubChem (NCBI)