Products 71942-06-8

CAS 71942-06-8 is the registry number for 2-(7-Hydroxy-8-methoxy-2-oxo-2H-chromen-6-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(7-hydroxy-8-methoxy-2-oxochromen-6-yl)acetic acid (CAS 71942-06-8) is a chemical compound with the molecular formula C12H10O6 and a molecular weight of 250.20 g/mol. IUPAC name: 2-(7-hydroxy-8-methoxy-2-oxochromen-6-yl)acetic acid. InChIKey: GTNVEZOXYSMNTC-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10O6
Molecular weight250.20 g/mol
IUPAC name2-(7-hydroxy-8-methoxy-2-oxochromen-6-yl)acetic acid
InChIKeyGTNVEZOXYSMNTC-UHFFFAOYSA-N
SMILESCOC1=C2C(=CC(=C1O)CC(=O)O)C=CC(=O)O2

Computed by PubChem (NCBI)