Products 86100-68-7
CAS 86100-68-7 is the registry number for 6,7-Dimethoxy-2-oxo-2H-chromene-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6,7-dimethoxy-2-oxochromene-3-carboxylic acid (CAS 86100-68-7) is a chemical compound with the molecular formula C12H10O6 and a molecular weight of 250.20 g/mol. IUPAC name: 6,7-dimethoxy-2-oxochromene-3-carboxylic acid. InChIKey: XZPABFKZRALOPV-UHFFFAOYSA-N.
| Molecular formula | C12H10O6 |
|---|---|
| Molecular weight | 250.20 g/mol |
| IUPAC name | 6,7-dimethoxy-2-oxochromene-3-carboxylic acid |
| InChIKey | XZPABFKZRALOPV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C=C(C(=O)O2)C(=O)O)OC |
Computed by PubChem (NCBI)